Jump to:
loading...| Preferred Name |
mandelic acid |
|
| Synonyms |
|
|
| Definitions |
A 2-hydroxy monocarboxylic acid that has formula C8H8O3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_35825 |
|
| alternative term |
C8H8O3 alpha-hydroxybenzeneacetic acid Mandelsaeure InChI=1S/C8H8O3/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7,9H,(H,10,11) InChIKey=IWYDHOAUDWTVEP-UHFFFAOYSA-N OC(C(O)=O)c1ccccc1 hydroxy(phenyl)acetic acid |
|
| definition |
A 2-hydroxy monocarboxylic acid that has formula C8H8O3. |
|
| has functional parent | ||
| is conjugate acid of | ||
| label |
mandelic acid |
|
| prefixIRI |
CHEBI:35825 |
|
| prefLabel |
mandelic acid |
|
| subClassOf |
Create mapping