loading...| Preferred Name |
cephapirin sodium |
|
| Synonyms |
|
|
| Definitions |
The sodium salt of cephapirin. A first-generation cephalosporin antibiotic, it is effective against gram-negative and gram-positive organisms. Being more resistant to beta-lactamases than penicillins, it is effective agains most staphylococci, though not methicillin-resistant staphylococci. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3545 |
|
| alternative term |
C17H16N3NaO6S2 Cefapirin sodium Sodium cefapirin [Na+].[H][C@]12SCC(COC(C)=O)=C(N1C(=O)[C@H]2NC(=O)CSc1ccncc1)C([O-])=O sodium (6R,7R)-3-[(acetyloxy)methyl]-8-oxo-7-{[(pyridin-4-ylsulfanyl)acetyl]amino}-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Cephapirin sodium InChI=1S/C17H17N3O6S2.Na/c1-9(21)26-6-10-7-28-16-13(15(23)20(16)14(10)17(24)25)19-12(22)8-27-11-2-4-18-5-3-11;/h2-5,13,16H,6-8H2,1H3,(H,19,22)(H,24,25);/q;+1/p-1/t13-,16-;/m1./s1 sodium 7-(pyrid-4-ylthioacetamido)cephalosporanate InChIKey=VGEOUKPOQQEQSX-OALZAMAHSA-M monosodium (6R,7R)-3-(hydroxymethyl)-8-oxo-7-(2-(4-pyridylthio)acetamido)-5-thia-1-azabicyclo(4.2.0)oct-2-ene-2-carboxylate acetate |
|
| definition |
The sodium salt of cephapirin. A first-generation cephalosporin antibiotic, it is effective against gram-negative and gram-positive organisms. Being more resistant to beta-lactamases than penicillins, it is effective agains most staphylococci, though not methicillin-resistant staphylococci. |
|
| has part | ||
| has role | ||
| label |
cephapirin sodium |
|
| prefixIRI |
CHEBI:3545 |
|
| prefLabel |
cephapirin sodium |
|
| subClassOf |