Jump to:
loading...| Preferred Name |
2,6-di-tert-butyl-4-methylphenol |
|
| Synonyms |
|
|
| Definitions |
A phenol that has formula C15H24O. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34247 |
|
| alternative term |
InChIKey=NLZUEZXRPGMBCV-UHFFFAOYSA-N Cc1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C 2,6-Bis(1,1-dimethylethyl)-4-methylphenol Butylated hydroxytoluene 2,6-Di-t-butyl-4-methylphenol C15H24O InChI=1S/C15H24O/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7/h8-9,16H,1-7H3 2,6-Di-tert-butyl-4-cresol 2,6-Di-tert-butyl-p-cresol BHT Butylhydroxytoluene 2,6-Di-tert-butyl-1-hydroxy-4-methylbenzene |
|
| definition |
A phenol that has formula C15H24O. |
|
| has functional parent | ||
| label |
2,6-di-tert-butyl-4-methylphenol |
|
| prefixIRI |
CHEBI:34247 |
|
| prefLabel |
2,6-di-tert-butyl-4-methylphenol |
|
| subClassOf |
Create mapping