Preferred Name |
methylphenidate hydrochloride |
|
Synonyms |
|
|
Definitions |
A hydrochloride that has formula C14H19NO2.HCl. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_31836 |
|
alternative term |
[Cl-].COC(=O)C(C1CCCC[NH2+]1)c1ccccc1 methylphenidylacetate hydrochloride 2-(2-methoxy-2-oxo-1-phenylethyl)piperidinium chloride InChIKey=JUMYIBMBTDDLNG-UHFFFAOYSA-N Ritalin C14H19NO2.HCl InChI=1S/C14H19NO2.ClH/c1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12;/h2-4,7-8,12-13,15H,5-6,9-10H2,1H3;1H Concerta methylphenidate HCl Metadate Centedrin |
|
definition |
A hydrochloride that has formula C14H19NO2.HCl. |
|
has part | ||
has role | ||
label |
methylphenidate hydrochloride |
|
prefixIRI |
CHEBI:31836 |
|
prefLabel |
methylphenidate hydrochloride |
|
subClassOf |
Create mapping