Preferred Name |
fluorescein |
|
Synonyms |
|
|
Definitions |
A highly fluorescent dye, detectable even when present in minute quantities. Used forensically to detect traces of blood, in analytical chemistry as an indicator in silver nitrate titrations and in microscopy. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_31624 |
|
alternative term |
Oc1ccc2c(Oc3cc(O)ccc3C22OC(=O)c3ccccc23)c1 3',6'-dihydroxyfluoran 9-(o-carboxyphenyl)-6-hydroxy-3H-xanthen-3-one resorcinolphthalein 9-(o-carboxyphenyl)-6-hydroxy-3-isoxanthenone InChI=1S/C20H12O5/c21-11-5-7-15-17(9-11)24-18-10-12(22)6-8-16(18)20(15)14-4-2-1-3-13(14)19(23)25-20/h1-10,21-22H InChIKey=GNBHRKFJIUUOQI-UHFFFAOYSA-N fluoresceine C20H12O5 3',6'-dihydroxy-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one 3,6-fluorandiol Fluoreszein |
|
definition |
A highly fluorescent dye, detectable even when present in minute quantities. Used forensically to detect traces of blood, in analytical chemistry as an indicator in silver nitrate titrations and in microscopy. |
|
has functional parent | ||
label |
fluorescein |
|
prefixIRI |
CHEBI:31624 |
|
prefLabel |
fluorescein |
|
subClassOf |