Jump to:
loading...| Preferred Name |
myristate |
|
| Synonyms |
|
|
| Definitions |
The conjugate base of myristic acid; major species at pH 7.3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30807 |
|
| alternative term |
n-tetradecoate tetradecoate tetradecanoate n-tetradecan-1-oate C14H27O2 CH3-[CH2]12-COO(-) 1-tetradecanecarboxylate InChIKey=TUNFSRHWOTWDNC-UHFFFAOYSA-M InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)/p-1 CCCCCCCCCCCCCC([O-])=O Tetradecanoate |
|
| definition |
The conjugate base of myristic acid; major species at pH 7.3. |
|
| is conjugate base of | ||
| label |
myristate |
|
| prefixIRI |
CHEBI:30807 |
|
| prefLabel |
myristate |
|
| subClassOf |
Create mapping