Jump to:
loading...| Preferred Name |
oxaloacetic acid |
|
| Synonyms |
|
|
| Definitions |
An oxo dicarboxylic acid that has formula C4H4O5. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30744 |
|
| alternative term |
2-oxosuccinic acid ketosuccinic acid 2-Oxobutanedioic acid keto-succinic acid 3-carboxy-3-oxopropanoic acid InChI=1S/C4H4O5/c5-2(4(8)9)1-3(6)7/h1H2,(H,6,7)(H,8,9) OC(=O)CC(=O)C(O)=O InChIKey=KHPXUQMNIQBQEV-UHFFFAOYSA-N 2-oxobutanedioic acid oxobutanedioic acid C4H4O5 OAA Oxalacetic acid Oxaloacetic acid Oxosuccinic acid |
|
| definition |
An oxo dicarboxylic acid that has formula C4H4O5. |
|
| has functional parent | ||
| is conjugate base of | ||
| label |
oxaloacetic acid |
|
| prefixIRI |
CHEBI:30744 |
|
| prefLabel |
oxaloacetic acid |
|
| subClassOf |
Create mapping