Jump to:
loading...| Preferred Name |
synephrine |
|
| Synonyms |
|
|
| Definitions |
An ethanolamine that has formula C9H13NO2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_29081 |
|
| alternative term |
1-(4-hydroxyphenyl)-2-(methylamino)ethanol beta-methylamino-alpha-(4-hydroxyphenyl)ethyl alcohol 4-hydroxy-alpha-[(methylamino)methyl]benzenemethanol C9H13NO2 Oxedrine CNCC(O)c1ccc(O)cc1 p-hydroxy-alpha-[(methylamino)methyl]benzyl alcohol 1-(4-hydroxyphenyl)-2-methylaminoethanol InChI=1S/C9H13NO2/c1-10-6-9(12)7-2-4-8(11)5-3-7/h2-5,9-12H,6H2,1H3 Synephrine InChIKey=YRCWQPVGYLYSOX-UHFFFAOYSA-N 1-(4-Hydroxyphenyl)-2-(methylamino)ethanol Sympatol |
|
| definition |
An ethanolamine that has formula C9H13NO2. |
|
| is conjugate base of | ||
| label |
synephrine |
|
| prefixIRI |
CHEBI:29081 |
|
| prefLabel |
synephrine |
|
| subClassOf |
Create mapping