Jump to:
loading...| Preferred Name |
psoralen |
|
| Synonyms |
|
|
| Definitions |
A member of the psoralens that has formula C11H6O3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27616 |
|
| alternative term |
6,7-furanocoumarin C11H6O3 Psoralen 7H-furo[3,2-g][1]benzopyran-7-one furo[2',3':7,6]coumarin psoralene 6-hydroxy-5-benzofuranacrylic acid delta-lactone InChIKey=ZCCUUQDIBDJBTK-UHFFFAOYSA-N O=c1ccc2cc3ccoc3cc2o1 furo[4',5':6,7]coumarin furocoumarin InChI=1S/C11H6O3/c12-11-2-1-7-5-8-3-4-13-9(8)6-10(7)14-11/h1-6H 3-(6-hydroxy-5-benzofuranyl)-2-propenoic acid delta-lactone Ficusin 7H-furo[3,2-g]chromen-7-one |
|
| definition |
A member of the psoralens that has formula C11H6O3. |
|
| label |
psoralen |
|
| prefixIRI |
CHEBI:27616 |
|
| prefLabel |
psoralen |
|
| subClassOf |
Create mapping