Preferred Name |
cinnamic acid |
|
Synonyms |
|
|
Definitions |
A styrene that has formula C9H8O2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27386 |
|
alternative term |
Zimtsaeure C9H8O2 benzenepropenoic acid InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11) benzylideneacetic acid 3-phenyl-2-propenoic acid InChIKey=WBYWAXJHAXSJNI-UHFFFAOYSA-N Cinnamic acid [H]C(=Cc1ccccc1)C(O)=O phenylacrylic acid 3-phenylacrylic acid beta-phenylacrylic acid 3-phenylprop-2-enoic acid |
|
definition |
A styrene that has formula C9H8O2. |
|
is conjugate acid of | ||
label |
cinnamic acid |
|
prefixIRI |
CHEBI:27386 |
|
prefLabel |
cinnamic acid |
|
subClassOf |
Create mapping