Jump to:
loading...| Preferred Name |
O-methylserotonin |
|
| Synonyms |
|
|
| Definitions |
A tryptamine that has formula C11H14N2O. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2089 |
|
| alternative term |
C11H14N2O 5-methoxy-1H-indole-3-ethanamine InChIKey=JTEJPPKMYBDEMY-UHFFFAOYSA-N 5-Methoxytryptamine InChI=1S/C11H14N2O/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11/h2-3,6-7,13H,4-5,12H2,1H3 5-MeOT 2-(5-methoxy-1H-indol-3-yl)ethanamine 3-(2-aminoethyl)-5-methoxyindole mexamine 2-(5-methoxyindol-3-yl)ethylamine 5MOT 5-MT COc1ccc2[nH]cc(CCN)c2c1 |
|
| definition |
A tryptamine that has formula C11H14N2O. |
|
| has functional parent | ||
| has role | ||
| label |
O-methylserotonin |
|
| prefixIRI |
CHEBI:2089 |
|
| prefLabel |
O-methylserotonin |
|
| subClassOf |
Create mapping
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_2089 | DINTO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_2089 | CHEBI | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_2089 | BERO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_2089 | NIFSTD | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_2089 | DINTO | LOOM |