Preferred Name |
butyrate |
|
Synonyms |
|
|
Definitions |
The conjugate base of butyric acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17968 |
|
alternative term |
n-butyrate C4H7O2 propanecarboxylate 1-butanoate 1-butyrate 1-propanecarboxylate propylformate CCCC([O-])=O InChI=1S/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 butanoate ethylacetate InChIKey=FERIUCNNQQJTOY-UHFFFAOYSA-M CH3-[CH2]2-COO(-) butyrate butanoic acid, ion(1-) n-butanoate butanate |
|
definition |
The conjugate base of butyric acid. |
|
is conjugate base of | ||
label |
butyrate |
|
prefixIRI |
CHEBI:17968 |
|
prefLabel |
butyrate |
|
subClassOf |
Create mapping