Jump to:
loading...| Preferred Name |
4-aminophenol |
|
| Synonyms |
|
|
| Definitions |
The one of three amino derivatives of phenol which has the single amino substituent located para to the phenolic -OH group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17602 |
|
| alternative term |
4-AMINOPHENOL 4-Aminobenzenol InChI=1S/C6H7NO/c7-5-1-3-6(8)4-2-5/h1-4,8H,7H2 Nc1ccc(O)cc1 4-Hydroxyaniline p-Aminophenol InChIKey=PLIKAWJENQZMHA-UHFFFAOYSA-N p-hydroxyaniline 4-aminophenol C6H7NO 4-Aminophenol |
|
| definition |
The one of three amino derivatives of phenol which has the single amino substituent located para to the phenolic -OH group. |
|
| label |
4-aminophenol |
|
| prefixIRI |
CHEBI:17602 |
|
| prefLabel |
4-aminophenol |
|
| subClassOf |
Create mapping