Jump to:
loading...| Preferred Name |
L-serine |
|
| Synonyms |
|
|
| Definitions |
The L-enantiomer of serine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17115 |
|
| alternative term |
(S)-2-amino-3-hydroxypropanoic acid (S)-serine InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1 SERINE L-3-Hydroxy-alanine InChIKey=MTCFGRXMJLQNBG-REOHCLBHSA-N Ser S L-Serin L-(-)-serine C3H7NO3 N[C@@H](CO)C(O)=O L-2-Amino-3-hydroxypropionic acid (S)-(-)-serine (2S)-2-amino-3-hydroxypropanoic acid L-Serine L-serine |
|
| definition |
The L-enantiomer of serine. |
|
| is conjugate acid of | ||
| is conjugate base of | ||
| is enantiomer of | ||
| is tautomer of | ||
| label |
L-serine |
|
| prefixIRI |
CHEBI:17115 |
|
| prefLabel |
L-serine |
|
| subClassOf |
Create mapping