Preferred Name |
4-hydroxybutyrate |
|
Synonyms |
|
|
Definitions |
A C4, hydroxy fatty acid anion and the conjugate base of 4-hydroxybutyric acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16724 |
|
alternative term |
4-hydroxybutanoate InChIKey=SJZRECIVHVDYJC-UHFFFAOYSA-M OCCCC([O-])=O gamma-hydroxybutyrate GHB C4H7O3 InChI=1S/C4H8O3/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7)/p-1 |
|
definition |
A C4, hydroxy fatty acid anion and the conjugate base of 4-hydroxybutyric acid. |
|
has functional parent | ||
is conjugate acid of | ||
label |
4-hydroxybutyrate |
|
prefixIRI |
CHEBI:16724 |
|
prefLabel |
4-hydroxybutyrate |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_58951 |
Create mapping