Jump to:
loading...| Preferred Name |
O-phospho-L-serine |
|
| Synonyms |
|
|
| Definitions |
The L-enantiomer of O-phosphoserine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_15811 |
|
| alternative term |
(2S)-2-amino-3-(phosphonooxy)propanoic acid O-phosphoserine InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-N O-phosphono-L-serine (S)-2-amino-3-hydroxypropanoic acid 3-phosphate L-O-Phosphoserine O-Phospho-L-serine C3H8NO6P (+)-L-serine dihydrogen phosphate (ester) N[C@@H](COP(O)(O)=O)C(O)=O 3-Phosphoserine InChI=1S/C3H8NO6P/c4-2(3(5)6)1-10-11(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)/t2-/m0/s1 dexfosfoserine |
|
| definition |
The L-enantiomer of O-phosphoserine. |
|
| is conjugate acid of | ||
| is enantiomer of | ||
| label |
O-phospho-L-serine |
|
| prefixIRI |
CHEBI:15811 |
|
| prefLabel |
O-phospho-L-serine |
|
| subClassOf |
Create mapping