Preferred Name |
norfloxacin |
|
Synonyms |
|
|
Definitions |
A synthetic fluoroquinolone with broad-spectrum antibacterial activity against most gram-negative and gram-positive bacteria. Norfloxacin is bactericidal and its mode of action depends on blocking of bacterial DNA replication by binding itself to an enzyme called DNA gyrase. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_100246 |
|
alternative term |
1-Ethyl-6-fluor-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-chinolincarbonsaeure 1,4-Dihydro-1-ethyl-6-fluoro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid norfloxacino NFLX 1-Ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid InChIKey=OGJPXUAPXNRGGI-UHFFFAOYSA-N C16H18FN3O3 CCn1cc(C(O)=O)c(=O)c2cc(F)c(cc12)N1CCNCC1 norfloxacin InChI=1S/C16H18FN3O3/c1-2-19-9-11(16(22)23)15(21)10-7-12(17)14(8-13(10)19)20-5-3-18-4-6-20/h7-9,18H,2-6H2,1H3,(H,22,23) norfloxacinum norfloxacine 1-ethyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid |
|
definition |
A synthetic fluoroquinolone with broad-spectrum antibacterial activity against most gram-negative and gram-positive bacteria. Norfloxacin is bactericidal and its mode of action depends on blocking of bacterial DNA replication by binding itself to an enzyme called DNA gyrase. |
|
has role | ||
label |
norfloxacin |
|
prefixIRI |
CHEBI:100246 |
|
prefLabel |
norfloxacin |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_37143 http://purl.obolibrary.org/obo/CHEBI_46848 |