loading...| Preferred Name |
sodium valproate |
|
| Synonyms |
Valproate sodium valproic acid sodium salt 2-Propylvaleric acid sodium salt Depakene Epilim sodium 2-propylpentanoate |
|
| Definitions |
The sodium salt of valproic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9925 |
|
| alternative term |
Valproate sodium valproic acid sodium salt 2-Propylvaleric acid sodium salt Depakene Epilim sodium 2-propylpentanoate |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
KEGG:D00710 CAS:1069-66-5 KEGG:C07842 PMID:18248662 DrugBank:DBSALT001257 |
|
| definition |
The sodium salt of valproic acid. |
|
| formula |
C8H15O2Na |
|
| has part | ||
| has_exact_synonym |
sodium 2-propylpentanoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Valproate sodium valproic acid sodium salt 2-Propylvaleric acid sodium salt Depakene Epilim |
|
| id |
CHEBI:9925 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H16O2.Na/c1-3-5-7(6-4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+1/p-1 |
|
| inchikey |
AEQFSUDEHCCHBT-UHFFFAOYSA-M |
|
| label |
sodium valproate |
|
| mass |
166.19327 |
|
| monoisotopicmass |
166.09697 |
|
| notation |
CHEBI:9925 |
|
| overlaps | ||
| prefLabel |
sodium valproate |
|
| RO_0000087 | ||
| smiles |
[Na+].CCCC(CCC)C([O-])=O |
|
| subClassOf |