Preferred Name |
propafenone hydrochloride |
|
Synonyms |
1-{2-[2-hydroxy-3-(propylamino)propoxy]phenyl}-3-phenylpropan-1-one hydrochloride Propafenon hydrochlorid propafenone HCl 2-hydroxy-3-[2-(3-phenylpropanoyl)phenoxy]-N-propylpropan-1-aminium chloride Arythmol Rythmol |
|
Definitions |
A hydrochloride that is the monohydrochloride salt of propafenone. It is a class 1C antiarrhythmic drug with local anesthetic effects, and is used in the management of supraventricular and ventricular arrhythmias. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_8466 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB01182 Reaxys:4343069 KEGG:D00640 CAS:34183-22-7 |
|
definition |
A hydrochloride that is the monohydrochloride salt of propafenone. It is a class 1C antiarrhythmic drug with local anesthetic effects, and is used in the management of supraventricular and ventricular arrhythmias. |
|
formula |
C21H27NO3.HCl C21H28ClNO3 |
|
has part | ||
has_exact_synonym |
1-{2-[2-hydroxy-3-(propylamino)propoxy]phenyl}-3-phenylpropan-1-one hydrochloride |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Propafenon hydrochlorid propafenone HCl 2-hydroxy-3-[2-(3-phenylpropanoyl)phenoxy]-N-propylpropan-1-aminium chloride Arythmol Rythmol |
|
id |
CHEBI:8466 |
|
in_subset | ||
inchi |
InChI=1S/C21H27NO3.ClH/c1-2-14-22-15-18(23)16-25-21-11-7-6-10-19(21)20(24)13-12-17-8-4-3-5-9-17;/h3-11,18,22-23H,2,12-16H2,1H3;1H |
|
inchikey |
XWIHRGFIPXWGEF-UHFFFAOYSA-N |
|
label |
propafenone hydrochloride |
|
mass |
377.90500 |
|
monoisotopicmass |
377.17577 |
|
notation |
CHEBI:8466 |
|
prefLabel |
propafenone hydrochloride |
|
RO_0000087 | ||
smiles |
Cl.CCCNCC(O)COc1ccccc1C(=O)CCc1ccccc1 |
|
subClassOf |