Preferred Name |
antazoline |
|
Synonyms |
N-benzyl-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline 4,5-Dihydro-N-phenyl-N-phenylmethyl-1H-imidazole-2-methanamine antazolinum 2-(N-Phenyl-N-benzylaminomethyl)imidazoline 2-(N-Benzylanilinomethyl)-2-imidazoline antazolina antazoline |
|
Definitions |
A member of the class of imidazolines that is 2-aminomethyl-2-imidazoline in which the exocyclic amino hydrogens are replaced by benzyl and phenyl groups. Antazoline is only found in individuals that have taken the drug. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_84115 |
|
charge |
0 |
|
database_cross_reference |
PMID:23669609 HMDB:HMDB0015689 Reaxys:233924 Drug_Central:224 LINCS:LSM-6023 PMID:3793827 PMID:22967497 PMID:16394564 PMID:7199833 PMID:9145778 Wikipedia:Antazoline PMID:23990192 KEGG:D07458 CAS:91-75-8 PMID:5792228 PMID:712601 DrugBank:DB08799 PMID:23847054 PMID:1180129 |
|
definition |
A member of the class of imidazolines that is 2-aminomethyl-2-imidazoline in which the exocyclic amino hydrogens are replaced by benzyl and phenyl groups. Antazoline is only found in individuals that have taken the drug. |
|
formula |
C17H19N3 |
|
has_exact_synonym |
N-benzyl-N-(4,5-dihydro-1H-imidazol-2-ylmethyl)aniline |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4,5-Dihydro-N-phenyl-N-phenylmethyl-1H-imidazole-2-methanamine antazolinum 2-(N-Phenyl-N-benzylaminomethyl)imidazoline 2-(N-Benzylanilinomethyl)-2-imidazoline antazolina antazoline |
|
id |
CHEBI:84115 |
|
in_subset | ||
inchi |
InChI=1S/C17H19N3/c1-3-7-15(8-4-1)13-20(14-17-18-11-12-19-17)16-9-5-2-6-10-16/h1-10H,11-14H2,(H,18,19) |
|
inchikey |
REYFJDPCWQRWAA-UHFFFAOYSA-N |
|
label |
antazoline |
|
mass |
265.35290 |
|
monoisotopicmass |
265.15790 |
|
notation |
CHEBI:84115 |
|
prefLabel |
antazoline |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_37955 |
|
smiles |
C(N(Cc1ccccc1)c1ccccc1)C1=NCCN1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33860 |