loading...| Preferred Name |
boscalid |
|
| Synonyms |
2-chloro-N-(4'-chlorobiphenyl-2-yl)nicotinamide 2-chloro-N-(4'-chloro[1,1'-biphenyl]-2-yl)pyridine-3-carboxamide 2-chloro-N-(4'-chloro[1,1'-biphenyl]-2-yl)-3-pyridinecarboxamide |
|
| Definitions |
A pyridinecarboxamide obtained by formal condensation of the carboxy group of 2-chloronicotinic acid with the amino group of 4'-chlorobiphenyl-2-amine. A fungicide active against a broad range of fungal pathogens including Botrytis spp., Alternaria spp. and Sclerotinia spp. for use on a wide range of crops including fruit, vegetables and ornamentals. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_81822 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:10092464 PMID:24893153 PMID:24936710 PMID:24711278 KEGG:C18547 PMID:24901961 CAS:188425-85-6 Pesticides:boscalid PMID:24380616 PPDB:86 |
|
| definition |
A pyridinecarboxamide obtained by formal condensation of the carboxy group of 2-chloronicotinic acid with the amino group of 4'-chlorobiphenyl-2-amine. A fungicide active against a broad range of fungal pathogens including Botrytis spp., Alternaria spp. and Sclerotinia spp. for use on a wide range of crops including fruit, vegetables and ornamentals. |
|
| formula |
C18H12Cl2N2O |
|
| has_exact_synonym |
2-chloro-N-(4'-chlorobiphenyl-2-yl)nicotinamide |
|
| has_functional_parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-chloro-N-(4'-chloro[1,1'-biphenyl]-2-yl)pyridine-3-carboxamide 2-chloro-N-(4'-chloro[1,1'-biphenyl]-2-yl)-3-pyridinecarboxamide |
|
| id |
CHEBI:81822 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H12Cl2N2O/c19-13-9-7-12(8-10-13)14-4-1-2-6-16(14)22-18(23)15-5-3-11-21-17(15)20/h1-11H,(H,22,23) |
|
| inchikey |
WYEMLYFITZORAB-UHFFFAOYSA-N |
|
| label |
boscalid |
|
| mass |
343.20700 |
|
| monoisotopicmass |
342.03267 |
|
| notation |
CHEBI:81822 |
|
| prefLabel |
boscalid |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_86328 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
| smiles |
Clc1ccc(cc1)-c1ccccc1NC(=O)c1cccnc1Cl |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_25529 http://purl.obolibrary.org/obo/CHEBI_22888 |