loading...| Preferred Name |
phenylephrine hydrochloride |
|
| Synonyms |
3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol hydrochloride Neo-Synephrine Dionephrine Mydfrin |
|
| Definitions |
A hydrochloride that is the monohydrochloride salt of phenylephrine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8094 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:US1954389 Wikipedia:Phenylephrine Beilstein:4158948 DrugBank:DB00388 Patent:US1932347 KEGG:D00511 CAS:61-76-7 |
|
| definition |
A hydrochloride that is the monohydrochloride salt of phenylephrine. |
|
| formula |
C9H13NO2.HCl C9H14ClNO2 |
|
| has part | ||
| has_exact_synonym |
3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Neo-Synephrine Dionephrine Mydfrin |
|
| id |
CHEBI:8094 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H13NO2.ClH/c1-10-6-9(12)7-3-2-4-8(11)5-7;/h2-5,9-12H,6H2,1H3;1H/t9-;/m0./s1 |
|
| inchikey |
OCYSGIYOVXAGKQ-FVGYRXGTSA-N |
|
| label |
phenylephrine hydrochloride |
|
| mass |
203.66570 |
|
| monoisotopicmass |
203.07131 |
|
| notation |
CHEBI:8094 |
|
| prefLabel |
phenylephrine hydrochloride |
|
| smiles |
[H+].[Cl-].CNC[C@H](O)c1cccc(O)c1 |
|
| subClassOf |