loading...| Preferred Name |
oxymetazoline hydrochloride |
|
| Synonyms |
6-tert-butyl-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,4-dimethylphenol hydrochloride 2-(4-tert-butyl-3-hydroxy-2,6-dimethylbenzyl)-4,5-dihydro-1H-imidazol-1-ium chloride 2,6-dimethyl-2-(4-tertiarybutyl-3-hydroxyphenyl)methylimidazoline hydrochloride 2-(4-t-butyl-2,6-dimethyl-3-hydroxybenzyl)-2-imidazolinium chloride oxymetazoline HCl Afrazine Ocuclear Sinex |
|
| Definitions |
A hydrochloride salt resulting from the reaction of equimolar quantities of oxymetazoline and hydrogen chloride. A direct-acting sympathomimetic with marked alpha-adrenergic activity, it is a vasoconstrictor that is used to relieve nasal congestion. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7863 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:2315-02-8 HMDB:HMDB0015070 PMID:23257339 Reaxys:5462995 PMID:23988443 PMID:10501820 KEGG:D01022 DrugBank:DB00935 PMID:11243242 PMID:17152641 |
|
| definition |
A hydrochloride salt resulting from the reaction of equimolar quantities of oxymetazoline and hydrogen chloride. A direct-acting sympathomimetic with marked alpha-adrenergic activity, it is a vasoconstrictor that is used to relieve nasal congestion. |
|
| formula |
C16H25ClN2O |
|
| has part | ||
| has_exact_synonym |
6-tert-butyl-3-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2,4-dimethylphenol hydrochloride 2-(4-tert-butyl-3-hydroxy-2,6-dimethylbenzyl)-4,5-dihydro-1H-imidazol-1-ium chloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2,6-dimethyl-2-(4-tertiarybutyl-3-hydroxyphenyl)methylimidazoline hydrochloride 2-(4-t-butyl-2,6-dimethyl-3-hydroxybenzyl)-2-imidazolinium chloride oxymetazoline HCl Afrazine Ocuclear Sinex |
|
| id |
CHEBI:7863 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H24N2O.ClH/c1-10-8-13(16(3,4)5)15(19)11(2)12(10)9-14-17-6-7-18-14;/h8,19H,6-7,9H2,1-5H3,(H,17,18);1H |
|
| inchikey |
BEEDODBODQVSIM-UHFFFAOYSA-N |
|
| label |
oxymetazoline hydrochloride |
|
| mass |
296.83600 |
|
| monoisotopicmass |
296.16554 |
|
| notation |
CHEBI:7863 |
|
| prefLabel |
oxymetazoline hydrochloride |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35524 http://purl.obolibrary.org/obo/CHEBI_35569 |
|
| smiles |
Cl.Cc1cc(c(O)c(C)c1CC1=NCCN1)C(C)(C)C |
|
| subClassOf |