Preferred Name |
(+)-menthol |
|
Synonyms |
(1S,2R,5S)-2-isopropyl-5-methylcyclohexanol (+)-(1S,3S,4R)-menthol (1S,2R,5S)-menthol (1S,2R,5S)-(+)-menthol (+)-(1S,2R,5S)-menthol D-menthol d-menthol |
|
Definitions |
A p-menthan-3-ol which has (1S,2R,5S)-stereochemistry. In contrast to (-)-menthol, the (+)-enantiomer occurs only rarely in nature. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_76306 |
|
charge |
0 |
|
database_cross_reference |
PMID:18640220 PMID:20932885 CAS:15356-60-2 Reaxys:1902292 |
|
definition |
A p-menthan-3-ol which has (1S,2R,5S)-stereochemistry. In contrast to (-)-menthol, the (+)-enantiomer occurs only rarely in nature. |
|
formula |
C10H20O |
|
has_exact_synonym |
(1S,2R,5S)-2-isopropyl-5-methylcyclohexanol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(+)-(1S,3S,4R)-menthol (1S,2R,5S)-menthol (1S,2R,5S)-(+)-menthol (+)-(1S,2R,5S)-menthol D-menthol d-menthol |
|
id |
CHEBI:76306 |
|
in_subset | ||
inchi |
InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m0/s1 |
|
inchikey |
NOOLISFMXDJSKH-AEJSXWLSSA-N |
|
is_enantiomer_of | ||
label |
(+)-menthol |
|
mass |
156.26520 |
|
monoisotopicmass |
156.15142 |
|
notation |
CHEBI:76306 |
|
prefLabel |
(+)-menthol |
|
smiles |
CC(C)[C@H]1CC[C@H](C)C[C@@H]1O |
|
subClassOf |