loading...| Preferred Name |
2-(4-chloro-2-methylphenoxy)propanoic acid |
|
| Synonyms |
2-(4-chloro-2-methylphenoxy)propanoic acid 2-(4-chloro-2-methylphenoxy)propionic acid 4-Chloro-2-methylphenoxy-alpha-propionic acid O-(4-chloro-2-methylphenyl)lactic acid 2-(4-Chloro-2-tolyloxy)propionic acid 2-(p-Chloro-o-tolyloxy)propionic acid Mecoprop |
|
| Definitions |
A monocarboxylic acid that is lactic acid in which the hydroxyl hydrogen is replaced by a 4-chloro-2-methylphenyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_75704 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:2212752 Wikipedia:Mecoprop KEGG:C18742 CAS:93-65-2 |
|
| definition |
A monocarboxylic acid that is lactic acid in which the hydroxyl hydrogen is replaced by a 4-chloro-2-methylphenyl group. |
|
| formula |
C10H11ClO3 |
|
| has_exact_synonym |
2-(4-chloro-2-methylphenoxy)propanoic acid |
|
| has_functional_parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-(4-chloro-2-methylphenoxy)propionic acid 4-Chloro-2-methylphenoxy-alpha-propionic acid O-(4-chloro-2-methylphenyl)lactic acid 2-(4-Chloro-2-tolyloxy)propionic acid 2-(p-Chloro-o-tolyloxy)propionic acid Mecoprop |
|
| id |
CHEBI:75704 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13) |
|
| inchikey |
WNTGYJSOUMFZEP-UHFFFAOYSA-N |
|
| label |
2-(4-chloro-2-methylphenoxy)propanoic acid |
|
| mass |
214.64600 |
|
| monoisotopicmass |
214.03967 |
|
| notation |
CHEBI:75704 |
|
| prefLabel |
2-(4-chloro-2-methylphenoxy)propanoic acid |
|
| smiles |
CC(Oc1ccc(Cl)cc1C)C(O)=O |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_75704 | CHEBI | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_75704 | GO-PLUS | SAME_URI | |
| http://purl.bioontology.org/ontology/RCD/X808D | RCD | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_75704 | CHEBI | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_75704 | GO-PLUS | LOOM | |
| http://purl.bioontology.org/ontology/SNOMEDCT/259114002 | SNOMEDCT | LOOM |