Preferred Name |
niclosamide |
|
Synonyms |
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide N-(2'-chloro-4'-nitrophenyl)-5-chlorosalicylamide 5-chloro-N-(2'-chloro-4'-nitrophenyl)salicylamide 2-hydroxy-5-chloro-N-(2-chloro-4-nitrophenyl)benzamide 2',5-dichloro-4'-nitrosalicylanilide 5-chloro-2'-chloro-4'-nitrosalicylanilide niclosamide niclosamida N-(2-chloro-4-nitrophenyl)-5-chlorosalicylamide 2',5-dichloro-2-hydroxy-4'-nitrobenzanilide Fedal-Telmin niclosamidum clonitralide 2-chloro-4-nitrophenylamide-6-chlorosalicylic acid Atenase B 2353 BAY 2353 Bayer 2353 Bayer 73 Bayluscide Cestocid Devermin Devermine Fenasal HL 2447 Helmiantin Iomesan Lintex Mansonil Mato Nasemo Niclocide Phenasal Radeverm Sagimid Sulqui Tredemine Utosamide Vermitid Vermitin WR 46234 Yomesan Zestocarp |
|
Definitions |
A secondary carboxamide resulting from the formal condensation of the carboxy group of 5-chlorosalicylic acid with the amino group of 2-chloro-4-nitroaniline. It is an oral anthelmintic drug approved for use against tapeworm infections. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7553 |
|
charge |
0 |
|
database_cross_reference |
PMID:33855343 PMID:34038481 PMID:24900231 PMID:34572856 PMID:34209118 PMID:34482191 PMID:33325188 Drug_Central:1912 Pesticides:niclosamide PMID:34483712 PMID:33870260 PMCID:PMC8308039 CAS:50-65-7 LINCS:LSM-2787 PMID:34638761 HMDB:HMDB0015679 Chemspider:4322 PMID:33860549 PMID:33772737 PMID:34512959 PMID:34517104 PMCID:PMC8508655 DrugBank:DB06803 PMID:34429248 Reaxys:2820605 Wikipedia:Niclosamide KEGG:D00436 PMID:34332199 PMID:34386088 PPDB:1929 VSDB:1929 |
|
definition |
A secondary carboxamide resulting from the formal condensation of the carboxy group of 5-chlorosalicylic acid with the amino group of 2-chloro-4-nitroaniline. It is an oral anthelmintic drug approved for use against tapeworm infections. |
|
formula |
C13H8Cl2N2O4 |
|
has_alternative_id |
CHEBI:92630 |
|
has_exact_synonym |
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
N-(2'-chloro-4'-nitrophenyl)-5-chlorosalicylamide 5-chloro-N-(2'-chloro-4'-nitrophenyl)salicylamide 2-hydroxy-5-chloro-N-(2-chloro-4-nitrophenyl)benzamide 2',5-dichloro-4'-nitrosalicylanilide 5-chloro-2'-chloro-4'-nitrosalicylanilide niclosamide niclosamida N-(2-chloro-4-nitrophenyl)-5-chlorosalicylamide 2',5-dichloro-2-hydroxy-4'-nitrobenzanilide Fedal-Telmin niclosamidum clonitralide 2-chloro-4-nitrophenylamide-6-chlorosalicylic acid Atenase B 2353 BAY 2353 Bayer 2353 Bayer 73 Bayluscide Cestocid Devermin Devermine Fenasal HL 2447 Helmiantin Iomesan Lintex Mansonil Mato Nasemo Niclocide Phenasal Radeverm Sagimid Sulqui Tredemine Utosamide Vermitid Vermitin WR 46234 Yomesan Zestocarp |
|
id |
CHEBI:7553 |
|
in_subset | ||
inchi |
InChI=1S/C13H8Cl2N2O4/c14-7-1-4-12(18)9(5-7)13(19)16-11-3-2-8(17(20)21)6-10(11)15/h1-6,18H,(H,16,19) |
|
inchikey |
RJMUSRYZPJIFPJ-UHFFFAOYSA-N |
|
label |
niclosamide |
|
mass |
327.120 |
|
monoisotopicmass |
325.98611 |
|
notation |
CHEBI:7553 |
|
prefLabel |
niclosamide |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_149553 http://purl.obolibrary.org/obo/CHEBI_167183 http://purl.obolibrary.org/obo/CHEBI_87183 http://purl.obolibrary.org/obo/CHEBI_68495 |
|
smiles |
OC1=CC=C(Cl)C=C1C(=O)NC1=C(Cl)C=C(C=C1)[N+]([O-])=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83403 http://purl.obolibrary.org/obo/CHEBI_140325 |