Preferred Name |
monothioglycerol |
|
Synonyms |
1-thio-2,3-propanediol 3-mercapto-1,2-propanediol 1-monothioglycerol 2,3-dihydroxypropanethiol thioglycerol alpha-thiolglycerol thioglycerin thioglycerine 1-thioglycerol 1-mercaptoglycerol 1-mercapto-2,3-propanediol 3-mercaptopropane-1,2-diol monothioglycerin monothioglycerol 3-sulfanylpropane-1,2-diol |
|
Definitions |
A thiol that is glycerol in which one of the primary hydroxy groups is replaced by a thiol group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_74537 |
|
alternative term |
1-thio-2,3-propanediol 3-mercapto-1,2-propanediol 1-monothioglycerol 2,3-dihydroxypropanethiol thioglycerol alpha-thiolglycerol thioglycerin thioglycerine 1-thioglycerol 1-mercaptoglycerol 1-mercapto-2,3-propanediol 3-mercaptopropane-1,2-diol monothioglycerin monothioglycerol 3-sulfanylpropane-1,2-diol |
|
bearer of | ||
charge |
0 |
|
database_cross_reference |
PMID:6362560 PMID:922117 CAS:96-27-5 Wikipedia:3-Mercaptopropane-1,2-diol PMID:18586770 KEGG:D05075 MetaCyc:CPD0-1951 PMID:6362561 Reaxys:1732046 PMID:6166247 |
|
definition |
A thiol that is glycerol in which one of the primary hydroxy groups is replaced by a thiol group. |
|
formula |
C3H8O2S |
|
has_exact_synonym |
monothioglycerol 3-sulfanylpropane-1,2-diol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1-thio-2,3-propanediol 3-mercapto-1,2-propanediol 1-monothioglycerol 2,3-dihydroxypropanethiol thioglycerol alpha-thiolglycerol thioglycerin thioglycerine 1-thioglycerol 1-mercaptoglycerol 1-mercapto-2,3-propanediol 3-mercaptopropane-1,2-diol monothioglycerin |
|
id |
CHEBI:74537 |
|
in_subset | ||
inchi |
InChI=1S/C3H8O2S/c4-1-3(5)2-6/h3-6H,1-2H2 |
|
inchikey |
PJUIMOJAAPLTRJ-UHFFFAOYSA-N |
|
label |
monothioglycerol |
|
mass |
108.15900 |
|
monoisotopicmass |
108.02450 |
|
notation |
CHEBI:74537 |
|
prefLabel |
monothioglycerol |
|
RO_0000087 | ||
smiles |
OCC(O)CS |
|
subClassOf |