loading...| Preferred Name |
malachite green |
|
| Synonyms |
(4-(alpha-(4-Dimethylamino)phenyl)benzylidene)cyclohexa-2,5-dien-1-ylidene dimethylammonium chloride (4-(4-Dimethylaminobenzhydriylidene)cyclohexa-2,5-dienylidene)dimethylammonium chloride CI Basic Green 4 C.I. Basic Green 4 diamond green B Basic Green 4 victoria green B malachite green chloride salt malachite green chloride C.I. 42000 CI 42000 4-{[4-(dimethylamino)phenyl](phenyl)methylene}-N,N-dimethylcyclohexa-2,5-dien-1-iminium chloride |
|
| Definitions |
An organic chloride salt that is the monochloride salt of malachite green cation. Used as a green-coloured dye, as a counter-stain in histology, and for its anti-fungal properties in aquaculture. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_72449 |
|
| alternative term |
(4-(alpha-(4-Dimethylamino)phenyl)benzylidene)cyclohexa-2,5-dien-1-ylidene dimethylammonium chloride (4-(4-Dimethylaminobenzhydriylidene)cyclohexa-2,5-dienylidene)dimethylammonium chloride CI Basic Green 4 C.I. Basic Green 4 diamond green B Basic Green 4 victoria green B malachite green chloride salt malachite green chloride C.I. 42000 CI 42000 4-{[4-(dimethylamino)phenyl](phenyl)methylene}-N,N-dimethylcyclohexa-2,5-dien-1-iminium chloride |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_50905 http://purl.obolibrary.org/obo/CHEBI_51217 http://purl.obolibrary.org/obo/CHEBI_33282 http://purl.obolibrary.org/obo/CHEBI_50903 http://purl.obolibrary.org/obo/CHEBI_86327 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23296502 Patent:WO2008063374 PMID:25945894 PMID:26250058 PMID:23286983 PMID:25699703 PMID:26003716 PMID:25409587 PMID:22526306 PMID:25218224 PMID:26057094 PMID:25441361 PMID:25497025 PMID:22236952 PMID:23323052 CAS:569-64-2 PMID:25462308 PMID:23199816 PMID:25128680 PMID:25236201 PMID:22623907 Wikipedia:Malachite_green PMID:25697373 Reaxys:3580148 PMID:25938698 PMID:25757145 PMID:25748983 PMID:26254991 KEGG:C18367 PMID:25542168 PMID:23203820 PMID:26185924 PMID:23122763 |
|
| definition |
An organic chloride salt that is the monochloride salt of malachite green cation. Used as a green-coloured dye, as a counter-stain in histology, and for its anti-fungal properties in aquaculture. |
|
| formula |
C23H25ClN2 |
|
| has part | ||
| has_exact_synonym |
4-{[4-(dimethylamino)phenyl](phenyl)methylene}-N,N-dimethylcyclohexa-2,5-dien-1-iminium chloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(4-(alpha-(4-Dimethylamino)phenyl)benzylidene)cyclohexa-2,5-dien-1-ylidene dimethylammonium chloride (4-(4-Dimethylaminobenzhydriylidene)cyclohexa-2,5-dienylidene)dimethylammonium chloride CI Basic Green 4 C.I. Basic Green 4 diamond green B Basic Green 4 victoria green B malachite green chloride salt malachite green chloride C.I. 42000 CI 42000 |
|
| id |
CHEBI:72449 |
|
| in_subset | ||
| inchi |
InChI=1S/C23H25N2.ClH/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4;/h5-17H,1-4H3;1H/q+1;/p-1 |
|
| inchikey |
FDZZZRQASAIRJF-UHFFFAOYSA-M |
|
| label |
malachite green |
|
| mass |
364.91100 |
|
| monoisotopicmass |
364.17063 |
|
| notation |
CHEBI:72449 |
|
| overlaps | ||
| prefLabel |
malachite green |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_50905 http://purl.obolibrary.org/obo/CHEBI_51217 http://purl.obolibrary.org/obo/CHEBI_33282 http://purl.obolibrary.org/obo/CHEBI_50903 http://purl.obolibrary.org/obo/CHEBI_86327 |
|
| smiles |
[Cl-].CN(C)c1ccc(cc1)C(c1ccccc1)=C1C=CC(C=C1)=[N+](C)C |
|
| subClassOf |