Preferred Name |
hydroxytyrosol |
|
Synonyms |
4-(2-hydroxyethyl)benzene-1,2-diol 3,4-dihydroxyphenylethanol dopet |
|
Definitions |
A member of the class of catechols that is benzene-1,2-diol substituted by a 2-hydroxyethyl group at position 4. Isolated from Olea europaea, it exhibits antioxidant and antineoplastic activities. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_68889 |
|
charge |
0 |
|
database_cross_reference |
PMID:22014120 PMID:22924436 PMID:23017390 Wikipedia:Hydroxytyrosol CAS:10597-60-1 Reaxys:2208118 PMID:23244583 LINCS:LSM-36968 |
|
definition |
A member of the class of catechols that is benzene-1,2-diol substituted by a 2-hydroxyethyl group at position 4. Isolated from Olea europaea, it exhibits antioxidant and antineoplastic activities. |
|
formula |
C8H10O3 |
|
has_exact_synonym |
4-(2-hydroxyethyl)benzene-1,2-diol |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
3,4-dihydroxyphenylethanol dopet |
|
id |
CHEBI:68889 |
|
in_subset | ||
inchi |
InChI=1S/C8H10O3/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,9-11H,3-4H2 |
|
inchikey |
JUUBCHWRXWPFFH-UHFFFAOYSA-N |
|
label |
hydroxytyrosol |
|
mass |
154.16320 |
|
monoisotopicmass |
154.06299 |
|
notation |
CHEBI:68889 |
|
prefLabel |
hydroxytyrosol |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
smiles |
OCCc1ccc(O)c(O)c1 |
|
subClassOf |