Preferred Name |
florbetapir F-18 |
|
Synonyms |
4-{(E)-2-[6-(2-{2-[2-((18)F)fluoroethoxy]ethoxy}ethoxy)pyridin-3-yl]ethenyl}-N-methylaniline Florbetapir Amyvid |
|
Definitions |
An aromatic ether consisting of a pyridine ring substituted at position 2 by a 2-{2-[2-((18)F)fluoroethoxy]ethoxy}ethoxy group and at position 5 and a 2-(4-methylaminophenyl)vinyl group. A positron emission tomography imaging ligand for the detection of amyloid aggregation associated with Alzheimer disease. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_66880 |
|
charge |
0 |
|
database_cross_reference |
PMID:22633529 PMID:22270508 PMID:22252372 PMID:22577238 KEGG:D09617 PMID:20638295 PMID:22156048 PMID:22786606 PMID:22354138 PMID:22786589 PMID:22331215 PMID:22749065 Drug_Central:4285 PMID:22791901 CAS:956103-76-7 PMID:21245183 PMID:21747008 |
|
definition |
An aromatic ether consisting of a pyridine ring substituted at position 2 by a 2-{2-[2-((18)F)fluoroethoxy]ethoxy}ethoxy group and at position 5 and a 2-(4-methylaminophenyl)vinyl group. A positron emission tomography imaging ligand for the detection of amyloid aggregation associated with Alzheimer disease. |
|
formula |
C20H25[18F]N2O3 |
|
has_exact_synonym |
4-{(E)-2-[6-(2-{2-[2-((18)F)fluoroethoxy]ethoxy}ethoxy)pyridin-3-yl]ethenyl}-N-methylaniline |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Florbetapir Amyvid |
|
id |
CHEBI:66880 |
|
in_subset | ||
inchi |
InChI=1S/C20H25FN2O3/c1-22-19-7-4-17(5-8-19)2-3-18-6-9-20(23-16-18)26-15-14-25-13-12-24-11-10-21/h2-9,16,22H,10-15H2,1H3/b3-2+/i21-1 |
|
inchikey |
YNDIAUKFXKEXSV-CRYLGTRXSA-N |
|
label |
florbetapir F-18 |
|
mass |
359.432 |
|
monoisotopicmass |
359.18746 |
|
notation |
CHEBI:66880 |
|
prefLabel |
florbetapir F-18 |
|
RO_0000087 | ||
smiles |
CNc1ccc(\C=C\c2ccc(OCCOCCOCC[18F])nc2)cc1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 http://purl.obolibrary.org/obo/CHEBI_37143 http://purl.obolibrary.org/obo/CHEBI_49127 |