loading...| Preferred Name |
aclidinium bromide |
|
| Synonyms |
(3R)-3-[2-hydroxy(di-2-thienyl)acetoxy]-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octane bromide Tudorza Pressair aclidinium bromide LAS 34273 |
|
| Definitions |
A quaternary ammonium salt that is the bromide salt of aclidinium. A muscarinic acetylcholine M3 receptor antagonist, for the long-term maintenance treatment of bronchospasm associated with chronic obstructive pulmonary disease (COPD). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_65344 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22541745 KEGG:D08837 PMID:21183326 PMID:19683590 PMID:20332199 PMID:20093184 PMID:22003291 PMID:19431081 PMID:22366196 PMID:22320148 PMID:19653626 PMID:21194604 PMID:20884687 PMID:21184745 PMID:20573081 Patent:US2005267078 PMID:21417951 PMID:19451700 Reaxys:11340576 PMID:19710368 PMID:19592595 PMID:21903737 Wikipedia:Aclidinium_bromide PMID:21628603 CAS:320345-99-1 PMID:20959525 PMID:22213116 PMID:20044242 PMID:21957094 PMID:20868661 PMID:19640353 |
|
| definition |
A quaternary ammonium salt that is the bromide salt of aclidinium. A muscarinic acetylcholine M3 receptor antagonist, for the long-term maintenance treatment of bronchospasm associated with chronic obstructive pulmonary disease (COPD). |
|
| formula |
C26H30BrNO4S2 |
|
| has part | ||
| has_exact_synonym |
(3R)-3-[2-hydroxy(di-2-thienyl)acetoxy]-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octane bromide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Tudorza Pressair aclidinium bromide LAS 34273 |
|
| id |
CHEBI:65344 |
|
| in_subset | ||
| inchi |
InChI=1S/C26H30NO4S2.BrH/c28-25(26(29,23-9-4-17-32-23)24-10-5-18-33-24)31-22-19-27(14-11-20(22)12-15-27)13-6-16-30-21-7-2-1-3-8-21;/h1-5,7-10,17-18,20,22,29H,6,11-16,19H2;1H/q+1;/p-1/t20?,22-,27?;/m0./s1 |
|
| inchikey |
XLAKJQPTOJHYDR-QTQXQZBYSA-M |
|
| label |
aclidinium bromide |
|
| mass |
564.55500 |
|
| monoisotopicmass |
563.07996 |
|
| notation |
CHEBI:65344 |
|
| prefLabel |
aclidinium bromide |
|
| RO_0000087 | ||
| smiles |
[Br-].OC(C(=O)O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2)(c1cccs1)c1cccs1 |
|
| subClassOf |