loading...| Preferred Name |
lomefloxacin hydrochloride |
|
| Synonyms |
1-ethyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid hydrochloride (+-)-1-ethyl-6,8-difluoro-1,4-dihydro-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid monohydrochloride lomefloxacin HCl |
|
| Definitions |
The hydrochloride salt of lomefloxacin. It is administered by mouth to treat bacterial infections including bronchitis and urinary tract infections. It is also used topically as eye drops for the treatment of bacterial conjunctivitis, and as ear drops for the treatment of otitis externa and otitis media. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6518 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C08053 CAS:98079-52-8 Reaxys:7506829 KEGG:D00873 DrugBank:DB00978 VSDB:1901 |
|
| definition |
The hydrochloride salt of lomefloxacin. It is administered by mouth to treat bacterial infections including bronchitis and urinary tract infections. It is also used topically as eye drops for the treatment of bacterial conjunctivitis, and as ear drops for the treatment of otitis externa and otitis media. |
|
| formula |
C17H20ClF2N3O3 |
|
| has part | ||
| has_exact_synonym |
1-ethyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(+-)-1-ethyl-6,8-difluoro-1,4-dihydro-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid monohydrochloride lomefloxacin HCl |
|
| id |
CHEBI:6518 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H19F2N3O3.ClH/c1-3-21-8-11(17(24)25)16(23)10-6-12(18)15(13(19)14(10)21)22-5-4-20-9(2)7-22;/h6,8-9,20H,3-5,7H2,1-2H3,(H,24,25);1H |
|
| inchikey |
KXEBLAPZMOQCKO-UHFFFAOYSA-N |
|
| label |
lomefloxacin hydrochloride |
|
| mass |
387.80900 |
|
| monoisotopicmass |
387.11613 |
|
| notation |
CHEBI:6518 |
|
| prefLabel |
lomefloxacin hydrochloride |
|
| RO_0000087 | ||
| smiles |
Cl.CCn1cc(C(O)=O)c(=O)c2cc(F)c(N3CCNC(C)C3)c(F)c12 |
|
| subClassOf |