loading...| Preferred Name |
memantine hydrochloride |
|
| Synonyms |
3,5-dimethyladamantan-1-amine hydrochloride 1-Amino-3,5-dimethyladamantane hydrochloride 3,5-Dimethyl-1-adamantanamine hydrochloride memantine.HCl 3,5-dimethyltricyclo(3.3.1.1(3,7))decan-1-amine hydrochloride Memantine HCl 3,5-dimethyladamantan-1-aminium chloride Namenda |
|
| Definitions |
A hydrochloride obtained by reaction of memantine with one equivalent of hydrochloric acid. A low to moderate affinity uncompetitive (open-channel); NMDA receptor antagonist which binds preferentially to the NMDA receptor-operated cation channels. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_64323 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB01043 PMID:22214393 PMID:21792308 PMID:20703320 PMID:21213317 PMID:19196860 CAS:41100-52-1 PMID:21268245 Patent:WO2011125062 PMID:21220675 PMID:20926740 Patent:US2011282100 PMID:21875407 KEGG:D04905 Reaxys:6573843 PMID:21893967 PMID:20013176 |
|
| definition |
A hydrochloride obtained by reaction of memantine with one equivalent of hydrochloric acid. A low to moderate affinity uncompetitive (open-channel); NMDA receptor antagonist which binds preferentially to the NMDA receptor-operated cation channels. |
|
| formula |
C12H22ClN |
|
| has part | ||
| has_exact_synonym |
3,5-dimethyladamantan-1-amine hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-Amino-3,5-dimethyladamantane hydrochloride 3,5-Dimethyl-1-adamantanamine hydrochloride memantine.HCl 3,5-dimethyltricyclo(3.3.1.1(3,7))decan-1-amine hydrochloride Memantine HCl 3,5-dimethyladamantan-1-aminium chloride Namenda |
|
| id |
CHEBI:64323 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H21N.ClH/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;/h9H,3-8,13H2,1-2H3;1H |
|
| inchikey |
LDDHMLJTFXJGPI-UHFFFAOYSA-N |
|
| label |
memantine hydrochloride |
|
| mass |
215.76300 |
|
| monoisotopicmass |
215.14408 |
|
| notation |
CHEBI:64323 |
|
| prefLabel |
memantine hydrochloride |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_48560 http://purl.obolibrary.org/obo/CHEBI_63726 http://purl.obolibrary.org/obo/CHEBI_35469 |
|
| smiles |
Cl.CC12CC3CC(C)(C1)CC(N)(C3)C2 |
|
| subClassOf |