Preferred Name |
spiramide |
|
Synonyms |
8-[3-(4-fluorophenoxy)propyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one AMI-193 espiramida spiramide spiramidum |
|
Definitions |
An azaspiro compound that consists of 1,3,8-triazaspiro[4.5]decan-4-one having a phenyl group attached to N-1 and a 3-(4-fluorophenoxy)propyl attached to N-8. Selective 5-HT antagonist, which binds to 5-HT2 sites as potently as spiperone but has lower affinity for 5-HT2C receptors. Also a high affinity D2 receptor antagonist (Ki = 3 nM). Lacks the disruptive effect of spiperone on animal behaviour. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_64207 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Spiramide Reaxys:631679 Patent:US3238216 CAS:510-74-7 PMID:4776656 PMID:4474849 PMID:19875674 LINCS:LSM-4124 PMID:17965538 PMID:11124389 |
|
definition |
An azaspiro compound that consists of 1,3,8-triazaspiro[4.5]decan-4-one having a phenyl group attached to N-1 and a 3-(4-fluorophenoxy)propyl attached to N-8. Selective 5-HT antagonist, which binds to 5-HT2 sites as potently as spiperone but has lower affinity for 5-HT2C receptors. Also a high affinity D2 receptor antagonist (Ki = 3 nM). Lacks the disruptive effect of spiperone on animal behaviour. |
|
formula |
C22H26FN3O2 |
|
has_exact_synonym |
8-[3-(4-fluorophenoxy)propyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
AMI-193 espiramida spiramide spiramidum |
|
id |
CHEBI:64207 |
|
in_subset | ||
inchi |
InChI=1S/C22H26FN3O2/c23-18-7-9-20(10-8-18)28-16-4-13-25-14-11-22(12-15-25)21(27)24-17-26(22)19-5-2-1-3-6-19/h1-3,5-10H,4,11-17H2,(H,24,27) |
|
inchikey |
FJUKDAZEABGEIH-UHFFFAOYSA-N |
|
label |
spiramide |
|
mass |
383.45910 |
|
monoisotopicmass |
383.20091 |
|
notation |
CHEBI:64207 |
|
prefLabel |
spiramide |
|
RO_0000087 | ||
smiles |
Fc1ccc(OCCCN2CCC3(CC2)N(CNC3=O)c2ccccc2)cc1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 http://purl.obolibrary.org/obo/CHEBI_37143 http://purl.obolibrary.org/obo/CHEBI_35624 |