loading...| Preferred Name |
ketorolac |
|
| Synonyms |
rac-5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid ketorolacum (+-)-5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid rac-ketorolac (+-)-ketorolac ketorolac ketorolaco |
|
| Definitions |
A racemate comprising equimolar amounts of (R)-(+)- and (S)-(-)-5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid. While only the (S)-(-) enantiomer is a COX1 and COX2 inhibitor, the (R)-(+) enantiomer exhibits potent analgesic activity. A non-steroidal anti-inflammatory drug, ketorolac is mainly used (generally as the tromethamine salt) for its potent analgesic properties in the short-term management of post-operative pain, and in eye drops to relieve the ocular itching associated with seasonal allergic conjunctivitis. It was withdrawn from the market in many countries in 1993 following association with haemorrhage and renal failure. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6129 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:9549656 PMID:19281996 PMID:23298250 KEGG:D08104 PMID:23473380 PMID:10223774 PMID:22191998 PMID:23562034 PMID:24022643 Wikipedia:Ketorolac Patent:BE856681 HMDB:HMDB0014608 PMID:23702435 Patent:US4089969 PMID:23179562 DrugBank:DB00465 CAS:74103-06-3 PMID:23447046 PMID:10027870 PMID:17456651 PMID:23126437 PMID:23653032 KEGG:C07062 PMID:28166217 Reaxys:413572 Patent:US4347186 PMID:10593468 PMID:24112670 PMID:23088994 |
|
| definition |
A racemate comprising equimolar amounts of (R)-(+)- and (S)-(-)-5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid. While only the (S)-(-) enantiomer is a COX1 and COX2 inhibitor, the (R)-(+) enantiomer exhibits potent analgesic activity. A non-steroidal anti-inflammatory drug, ketorolac is mainly used (generally as the tromethamine salt) for its potent analgesic properties in the short-term management of post-operative pain, and in eye drops to relieve the ocular itching associated with seasonal allergic conjunctivitis. It was withdrawn from the market in many countries in 1993 following association with haemorrhage and renal failure. |
|
| formula |
C15H13NO3 |
|
| has part | ||
| has_exact_synonym |
rac-5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
ketorolacum (+-)-5-benzoyl-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid rac-ketorolac (+-)-ketorolac ketorolac ketorolaco |
|
| id |
CHEBI:6129 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H13NO3/c17-14(10-4-2-1-3-5-10)13-7-6-12-11(15(18)19)8-9-16(12)13/h1-7,11H,8-9H2,(H,18,19) |
|
| inchikey |
OZWKMVRBQXNZKK-UHFFFAOYSA-N |
|
| is_conjugate_acid_of | ||
| label |
ketorolac |
|
| mass |
255.269 |
|
| monoisotopicmass |
255.08954 |
|
| notation |
CHEBI:6129 |
|
| prefLabel |
ketorolac |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_50629 http://purl.obolibrary.org/obo/CHEBI_35480 |
|
| smiles |
N12C(C(C(=O)O)CC1)=CC=C2C(=O)C3=CC=CC=C3 |
|
| subClassOf |