loading...| Preferred Name |
chloroxine |
|
| Synonyms |
5,7-dichloro-8-oxyquinoline 5,7-dichlorooxine 5,7-dichloro-8-hydroxyquinoline 5,7-dichloro-8-quinolinol 5,7-dichlor-8-hydroxychinolin 5,7-dichloroxine CHQ 5,7-dichloroquinolin-8-ol |
|
| Definitions |
A monohydroxyquinoline that is quinolin-8-ol in which the hydrogens at positions 5 and 7 have been substituted by chlorine. A synthetic antibacterial prepared by chlorination of quinolin-8-ol, it is used for the treatment of dandruff and seborrhoeic dermatitis of the scalp. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_59477 |
|
| alternative term |
5,7-dichloro-8-oxyquinoline 5,7-dichlorooxine 5,7-dichloro-8-hydroxyquinoline 5,7-dichloro-8-quinolinol 5,7-dichlor-8-hydroxychinolin 5,7-dichloroxine CHQ 5,7-dichloroquinolin-8-ol |
|
| bearer of |
http://purl.obolibrary.org/obo/CHEBI_59010 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:773-76-2 Reaxys:153606 LINCS:LSM-2371 PMID:18963921 Wikipedia:Chloroxine KEGG:D03472 PMID:443855 PMID:28166217 DrugBank:DB01243 Beilstein:153606 Drug_Central:611 |
|
| definition |
A monohydroxyquinoline that is quinolin-8-ol in which the hydrogens at positions 5 and 7 have been substituted by chlorine. A synthetic antibacterial prepared by chlorination of quinolin-8-ol, it is used for the treatment of dandruff and seborrhoeic dermatitis of the scalp. |
|
| formula |
C9H5Cl2NO |
|
| has_exact_synonym |
5,7-dichloroquinolin-8-ol |
|
| has_functional_parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
5,7-dichloro-8-oxyquinoline 5,7-dichlorooxine 5,7-dichloro-8-hydroxyquinoline 5,7-dichloro-8-quinolinol 5,7-dichlor-8-hydroxychinolin 5,7-dichloroxine CHQ |
|
| id |
CHEBI:59477 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H5Cl2NO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-4,13H |
|
| inchikey |
WDFKMLRRRCGAKS-UHFFFAOYSA-N |
|
| label |
chloroxine |
|
| mass |
214.04800 |
|
| monoisotopicmass |
212.97482 |
|
| notation |
CHEBI:59477 |
|
| prefLabel |
chloroxine |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_59010 |
|
| smiles |
Oc1c(Cl)cc(Cl)c2cccnc12 |
|
| subClassOf |