Preferred Name |
ifosfamide |
|
Synonyms |
N,3-bis(2-chloroethyl)-1,3,2-oxazaphosphinan-2-amine 2-oxide Isofosfamide ifosfamidum Iphosphamide 3-(2-chloroethyl)-2-((2-chloroethyl)amino)tetrahydro-2H-1,3,2-oxazaphosphorine 2-oxide Isophosphamide ifosfamida ifosfamide isosfamide |
|
Definitions |
The simplest member of the class of ifosfamides that is 1,3,2-oxazaphosphinan-2-amine 2-oxide substituted by 2-chloroethyl groups on both the nitrogen atoms respectively. It is a nitrogen mustard alkylating agent used in the treatment of advanced breast cancer. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_5864 |
|
charge |
0 |
|
database_cross_reference |
KEGG:C07047 KEGG:D00343 DrugBank:DB01181 CAS:3778-73-2 Beilstein:611835 PMID:11669554 PMID:11550152 LINCS:LSM-5118 Drug_Central:1421 Wikipedia:Ifosfamide Reaxys:5802893 HMDB:HMDB0015312 |
|
definition |
The simplest member of the class of ifosfamides that is 1,3,2-oxazaphosphinan-2-amine 2-oxide substituted by 2-chloroethyl groups on both the nitrogen atoms respectively. It is a nitrogen mustard alkylating agent used in the treatment of advanced breast cancer. |
|
formula |
C7H15Cl2N2O2P |
|
has_alternative_id |
CHEBI:219640 |
|
has_exact_synonym |
N,3-bis(2-chloroethyl)-1,3,2-oxazaphosphinan-2-amine 2-oxide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Isofosfamide ifosfamidum Iphosphamide 3-(2-chloroethyl)-2-((2-chloroethyl)amino)tetrahydro-2H-1,3,2-oxazaphosphorine 2-oxide Isophosphamide ifosfamida ifosfamide isosfamide |
|
id |
CHEBI:5864 |
|
in_subset | ||
inchi |
InChI=1S/C7H15Cl2N2O2P/c8-2-4-10-14(12)11(6-3-9)5-1-7-13-14/h1-7H2,(H,10,12) |
|
inchikey |
HOMGKSMUEGBAAB-UHFFFAOYSA-N |
|
label |
ifosfamide |
|
mass |
261.08600 |
|
monoisotopicmass |
260.02482 |
|
notation |
CHEBI:5864 |
|
prefLabel |
ifosfamide |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_35705 http://purl.obolibrary.org/obo/CHEBI_35610 |
|
smiles |
ClCCNP1(=O)OCCCN1CCCl |
|
subClassOf |