Preferred Name |
felodipine |
|
Synonyms |
ethyl methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate FELODIPINE felodipinum 3-ethyl 5-methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarboxylate (+-)-ethyl methyl 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic acid ethyl methyl ester felodipina felodipine |
|
Definitions |
The mixed (methyl, ethyl) diester of 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid. A calcium-channel blocker, it lowers blood pressure by reducing peripheral vascular resistance through a highly selective action on smooth muscle in arteriolar resistance vessels. It is used in the management of hypertension and angina pectoris. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_585948 |
|
charge |
0 |
|
database_cross_reference |
Patent:EP7293 PMID:18457386 DrugBank:DB01023 Patent:US4264611 CAS:72509-76-3 PDBeChem:225 Drug_Central:1142 Wikipedia:Felodipine KEGG:D00319 Reaxys:4331472 LINCS:LSM-1447 |
|
definition |
The mixed (methyl, ethyl) diester of 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid. A calcium-channel blocker, it lowers blood pressure by reducing peripheral vascular resistance through a highly selective action on smooth muscle in arteriolar resistance vessels. It is used in the management of hypertension and angina pectoris. |
|
formula |
C18H19Cl2NO4 |
|
has_alternative_id |
CHEBI:49383 CHEBI:4996 |
|
has_exact_synonym |
ethyl methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate FELODIPINE |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
felodipinum 3-ethyl 5-methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarboxylate (+-)-ethyl methyl 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic acid ethyl methyl ester felodipina felodipine |
|
id |
CHEBI:585948 |
|
in_subset | ||
inchi |
InChI=1S/C18H19Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8,15,21H,5H2,1-4H3 |
|
inchikey |
RZTAMFZIAATZDJ-UHFFFAOYSA-N |
|
label |
felodipine |
|
mass |
384.25400 |
|
monoisotopicmass |
383.06911 |
|
notation |
CHEBI:585948 |
|
prefLabel |
felodipine |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_38070 http://purl.obolibrary.org/obo/CHEBI_35620 |
|
smiles |
CCOC(=O)C1=C(C)NC(C)=C(C1c1cccc(Cl)c1Cl)C(=O)OC |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50075 http://purl.obolibrary.org/obo/CHEBI_23697 |