loading...| Preferred Name |
lactobionic acid |
|
| Synonyms |
4-(beta-D-galactosido)-D-gluconic acid 4-O-beta-D-galactopyranosyl-D-gluconic acid |
|
| Definitions |
A disaccharide formed between beta-D-galactose and D-gluconic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_55481 |
|
| alternative term |
4-(beta-D-galactosido)-D-gluconic acid 4-O-beta-D-galactopyranosyl-D-gluconic acid |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
CAS:96-82-2 LINCS:LSM-6520 Wikipedia:Lactobionic_acid |
|
| definition |
A disaccharide formed between beta-D-galactose and D-gluconic acid. |
|
| formula |
C12H22O12 |
|
| has_exact_synonym |
4-O-beta-D-galactopyranosyl-D-gluconic acid |
|
| has_functional_parent | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
4-(beta-D-galactosido)-D-gluconic acid |
|
| id |
CHEBI:55481 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H22O12/c13-1-3(15)10(7(18)8(19)11(21)22)24-12-9(20)6(17)5(16)4(2-14)23-12/h3-10,12-20H,1-2H2,(H,21,22)/t3-,4-,5+,6+,7-,8-,9-,10-,12+/m1/s1 |
|
| inchikey |
JYTUSYBCFIZPBE-AMTLMPIISA-N |
|
| is_conjugate_acid_of | ||
| label |
lactobionic acid |
|
| mass |
358.29590 |
|
| monoisotopicmass |
358.11113 |
|
| notation |
CHEBI:55481 |
|
| prefLabel |
lactobionic acid |
|
| RO_0000087 | ||
| smiles |
OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@@H](O)C(O)=O |
|
| subClassOf |