loading...| Preferred Name |
aceprometazine |
|
| Synonyms |
1-{10-[2-(dimethylamino)propyl]-10H-phenothiazin-2-yl}ethanone aceprometazinum 10-(2-(Dimethylamino)propyl)phenothiazin-2-yl methyl ketone aceprometazine aceprometazina Acepromethazine |
|
| Definitions |
A phenothiazine compound having an acetyl group at the 2-position and a 2-(dimethylamino)-1-propyl group at the 10-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_53770 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:38528 DrugBank:DB01615 Wikipedia:Aceprometazine CAS:13461-01-3 Beilstein:38528 Drug_Central:50 |
|
| definition |
A phenothiazine compound having an acetyl group at the 2-position and a 2-(dimethylamino)-1-propyl group at the 10-position. |
|
| formula |
C19H22N2OS |
|
| has_exact_synonym |
1-{10-[2-(dimethylamino)propyl]-10H-phenothiazin-2-yl}ethanone |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
aceprometazinum 10-(2-(Dimethylamino)propyl)phenothiazin-2-yl methyl ketone aceprometazine aceprometazina Acepromethazine |
|
| id |
CHEBI:53770 |
|
| in_subset | ||
| inchi |
InChI=1S/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3 |
|
| inchikey |
XLOQNFNTQIRSOX-UHFFFAOYSA-N |
|
| label |
aceprometazine |
|
| mass |
326.45600 |
|
| monoisotopicmass |
326.14528 |
|
| notation |
CHEBI:53770 |
|
| prefLabel |
aceprometazine |
|
| RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_37956 |
|
| smiles |
CC(CN1c2ccccc2Sc2ccc(cc12)C(C)=O)N(C)C |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_32876 http://purl.obolibrary.org/obo/CHEBI_76224 |