Preferred Name |
2-diethylaminoethanol |
|
Synonyms |
2-(diethylamino)ethanol N,N-diethyl-N-(beta-hydroxyethyl)amine beta-hydroxytriethylamine diethylethanolamine N,N-Diethyl-2-aminoethanol Diethyl(2-hydroxyethyl)amine diethylmonoethanolamine N,N-Diethylethanolamine Diethylaminoethanol beta-(diethylamino)ethyl alcohol DEAE |
|
Definitions |
A member of the class of ethanolamines that is aminoethanol in which the hydrogens of the amino group are replaced by ethyl groups. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_52153 |
|
charge |
0 |
|
database_cross_reference |
HMDB:HMDB0033971 Beilstein:741863 Reaxys:741863 CAS:100-37-8 Wikipedia:2-Diethylaminoethanol PMID:22325017 |
|
definition |
A member of the class of ethanolamines that is aminoethanol in which the hydrogens of the amino group are replaced by ethyl groups. |
|
formula |
C6H15NO |
|
has_exact_synonym |
2-(diethylamino)ethanol |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_parent_hydride | ||
has_related_synonym |
N,N-diethyl-N-(beta-hydroxyethyl)amine beta-hydroxytriethylamine diethylethanolamine N,N-Diethyl-2-aminoethanol Diethyl(2-hydroxyethyl)amine diethylmonoethanolamine N,N-Diethylethanolamine Diethylaminoethanol beta-(diethylamino)ethyl alcohol DEAE |
|
id |
CHEBI:52153 |
|
in_subset | ||
inchi |
InChI=1S/C6H15NO/c1-3-7(4-2)5-6-8/h8H,3-6H2,1-2H3 |
|
inchikey |
BFSVOASYOCHEOV-UHFFFAOYSA-N |
|
label |
2-diethylaminoethanol |
|
mass |
117.18940 |
|
monoisotopicmass |
117.11536 |
|
notation |
CHEBI:52153 |
|
prefLabel |
2-diethylaminoethanol |
|
smiles |
CCN(CC)CCO |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_23981 |