loading...| Preferred Name |
1-naphthylamine |
|
| Synonyms |
1-Naphthylamine naphthalen-1-amine naphthalen-1-ylamine alpha-aminonaphthalene 1-naphthalenamine alpha-naphthylamine 1-aminonaphthalene 1-Naphthylamin 1-naftilamina 1-naphthalamine |
|
| Definitions |
A naphthylamine that is naphthalene substituted by an amino group at position 1. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_50450 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23706116 CAS:134-32-7 PMID:24735928 KEGG:C14790 Beilstein:386133 Wikipedia:1-Naphthylamine Reaxys:386133 Gmelin:165496 |
|
| definition |
A naphthylamine that is naphthalene substituted by an amino group at position 1. |
|
| formula |
C10H9N |
|
| has_alternative_id |
CHEBI:50449 CHEBI:34098 |
|
| has_exact_synonym |
1-Naphthylamine naphthalen-1-amine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
naphthalen-1-ylamine alpha-aminonaphthalene 1-naphthalenamine alpha-naphthylamine 1-aminonaphthalene 1-Naphthylamin 1-naftilamina 1-naphthalamine |
|
| id |
CHEBI:50450 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,11H2 |
|
| inchikey |
RUFPHBVGCFYCNW-UHFFFAOYSA-N |
|
| label |
1-naphthylamine |
|
| mass |
143.18520 |
|
| monoisotopicmass |
143.07350 |
|
| notation |
CHEBI:50450 |
|
| prefLabel |
1-naphthylamine |
|
| RO_0000087 | ||
| smiles |
Nc1cccc2ccccc12 |
|
| subClassOf |