loading...| Preferred Name |
esomeprazole magnesium |
|
| Synonyms |
bis(5-methoxy-2-{(S)-[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}benzimidazol-1-ide) magnesium (-)-Omeprazole magnesium Axagon Esopral Lucen |
|
| Definitions |
A magnesium salt resulting from the formal reaction of magnesium hydroxide with 2 mol eq. of esomeprazole. An inhibitor of gastric acid secretion, it is used for the treatment of gastro-oesophageal reflux disease, dyspepsia, peptic ulcer disease, and Zollinger-Ellison syndrome. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_50309 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:11323157 CAS:161973-10-0 |
|
| definition |
A magnesium salt resulting from the formal reaction of magnesium hydroxide with 2 mol eq. of esomeprazole. An inhibitor of gastric acid secretion, it is used for the treatment of gastro-oesophageal reflux disease, dyspepsia, peptic ulcer disease, and Zollinger-Ellison syndrome. |
|
| formula |
(C17H18N3O3S)2.Mg C34H36MgN6O6S2 |
|
| has part | ||
| has_exact_synonym |
bis(5-methoxy-2-{(S)-[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}benzimidazol-1-ide) magnesium |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(-)-Omeprazole magnesium Axagon Esopral Lucen |
|
| id |
CHEBI:50309 |
|
| in_subset | ||
| inchi |
InChI=1S/2C17H18N3O3S.Mg/c2*1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17;/h2*5-8H,9H2,1-4H3;/q2*-1;+2/t2*24-;/m00./s1 |
|
| inchikey |
KWORUUGOSLYAGD-YPPDDXJESA-N |
|
| label |
esomeprazole magnesium |
|
| mass |
713.12100 |
|
| monoisotopicmass |
712.19882 |
|
| notation |
CHEBI:50309 |
|
| prefLabel |
esomeprazole magnesium |
|
| RO_0000087 | ||
| smiles |
[Mg++].COc1ccc2[n-]c(nc2c1)[S@@](=O)Cc1ncc(C)c(OC)c1C.COc1ccc2[n-]c(nc2c1)[S@@](=O)Cc1ncc(C)c(OC)c1C |
|
| subClassOf |