loading...| Preferred Name |
ethinamate |
|
| Synonyms |
ethinamatum 1-ethynylcyclohexanol carbamate Aethinyl-cyclohexyl-carbamat ethinamate etinamato 1-ethynylcyclohexyl carbamate Ethinamate |
|
| Definitions |
A carbamate ester that is the 1-vinylcyclohexyl ester of carbamic acid. A short-acting sedative-hypnotic, it was formerly used to treat insomnia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4884 |
|
| alternative term |
ethinamatum 1-ethynylcyclohexanol carbamate Aethinyl-cyclohexyl-carbamat ethinamate etinamato 1-ethynylcyclohexyl carbamate Ethinamate |
|
| bearer of | ||
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB01031 Reaxys:1946056 PMID:560472 Drug_Central:1081 Patent:US2816910 CAS:126-52-3 Wikipedia:Ethinamate KEGG:D00703 PMID:5252608 KEGG:C07832 PMID:2885000 HMDB:HMDB0015165 |
|
| definition |
A carbamate ester that is the 1-vinylcyclohexyl ester of carbamic acid. A short-acting sedative-hypnotic, it was formerly used to treat insomnia. |
|
| formula |
C9H13NO2 |
|
| has_alternative_id |
CHEBI:553538 |
|
| has_exact_synonym |
1-ethynylcyclohexyl carbamate Ethinamate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
ethinamatum 1-ethynylcyclohexanol carbamate Aethinyl-cyclohexyl-carbamat ethinamate etinamato |
|
| id |
CHEBI:4884 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H13NO2/c1-2-9(12-8(10)11)6-4-3-5-7-9/h1H,3-7H2,(H2,10,11) |
|
| inchikey |
GXRZIMHKGDIBEW-UHFFFAOYSA-N |
|
| label |
ethinamate |
|
| mass |
167.20500 |
|
| monoisotopicmass |
167.09463 |
|
| notation |
CHEBI:4884 |
|
| prefLabel |
ethinamate |
|
| RO_0000087 | ||
| smiles |
NC(=O)OC1(CCCCC1)C#C |
|
| subClassOf |