Preferred Name |
amylmetacresol |
|
Synonyms |
6-pentyl-m-cresol 6-amyl-m-cresol amylmetacresolum 6-n-pentyl-m-cresol 6-n-amyl-m-cresol 5-methyl-2-pentylphenol Amylmetacresol |
|
Definitions |
A phenol having the structure of m-cresol substituted at the 6-position with an amyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_48213 |
|
alternative term |
6-pentyl-m-cresol 6-amyl-m-cresol amylmetacresolum 6-n-pentyl-m-cresol 6-n-amyl-m-cresol 5-methyl-2-pentylphenol Amylmetacresol |
|
bearer of | ||
charge |
0 |
|
database_cross_reference |
CAS:1300-94-3 Beilstein:2440952 |
|
definition |
A phenol having the structure of m-cresol substituted at the 6-position with an amyl group. |
|
formula |
C12H18O |
|
has_exact_synonym |
5-methyl-2-pentylphenol Amylmetacresol |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
6-pentyl-m-cresol 6-amyl-m-cresol amylmetacresolum 6-n-pentyl-m-cresol 6-n-amyl-m-cresol |
|
id |
CHEBI:48213 |
|
in_subset | ||
inchi |
InChI=1S/C12H18O/c1-3-4-5-6-11-8-7-10(2)9-12(11)13/h7-9,13H,3-6H2,1-2H3 |
|
inchikey |
CKGWFZQGEQJZIL-UHFFFAOYSA-N |
|
label |
amylmetacresol |
|
mass |
178.27072 |
|
monoisotopicmass |
178.13577 |
|
notation |
CHEBI:48213 |
|
prefLabel |
amylmetacresol |
|
RO_0000087 | ||
smiles |
CCCCCc1ccc(C)cc1O |
|
subClassOf |