loading...| Preferred Name |
ecothiopate |
|
| Synonyms |
2-[(diethoxyphosphoryl)sulfanyl]-N,N,N-trimethylethanaminium ecothiopatum Echothiophate (2-diethoxyphosphinylthioethyl)trimethylammonium ecothiopate |
|
| Definitions |
The phosphorothioate obtained by formal condensation of diethyl phosphate with N,N,N-trimethyl-2-sulfanylethanaminium. An irreversible acetylcholinesterase inhibitor, its iodide salt is used an ocular antihypertensive in the treatment of open-angle glaucoma, particularly when other drugs have proved inadequate. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4753 |
|
| charge |
+1 |
|
| database_cross_reference |
Drug_Central:982 Wikipedia:Echothiophate Beilstein:1794025 DrugBank:DB01057 KEGG:C06975 CAS:6736-03-4 |
|
| definition |
The phosphorothioate obtained by formal condensation of diethyl phosphate with N,N,N-trimethyl-2-sulfanylethanaminium. An irreversible acetylcholinesterase inhibitor, its iodide salt is used an ocular antihypertensive in the treatment of open-angle glaucoma, particularly when other drugs have proved inadequate. |
|
| formula |
C9H23NO3PS |
|
| has_exact_synonym |
2-[(diethoxyphosphoryl)sulfanyl]-N,N,N-trimethylethanaminium |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
ecothiopatum Echothiophate (2-diethoxyphosphinylthioethyl)trimethylammonium ecothiopate |
|
| id |
CHEBI:4753 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H23NO3PS/c1-6-12-14(11,13-7-2)15-9-8-10(3,4)5/h6-9H2,1-5H3/q+1 |
|
| inchikey |
BJOLKYGKSZKIGU-UHFFFAOYSA-N |
|
| label |
ecothiopate |
|
| mass |
256.32300 |
|
| monoisotopicmass |
256.11308 |
|
| notation |
CHEBI:4753 |
|
| prefLabel |
ecothiopate |
|
| RO_0000087 | ||
| smiles |
CCOP(=O)(OCC)SCC[N+](C)(C)C |
|
| subClassOf |