Preferred Name |
dyclonine |
|
Synonyms |
1-(4-butoxyphenyl)-3-(piperidin-1-yl)propan-1-one 4-n-butoxy-beta-(1-piperidyl)propiophenone 3-piperidino-4'-butoxypropiophenone 2-(1-piperidyl)ethyl p-butoxyphenyl ketone 1-(4-butoxyphenyl)-3-(1-piperidinyl)-1-propanone 4'-butoxy-3-piperidinopropiophenone 4-butoxy-beta-piperidinopropiophenone diclonina dyclonine dycloninum |
|
Definitions |
N-Ethylpiperidine in which one of the hydrogens attached to the methyl group is substituted by a 4-butoxybenzoyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4724 |
|
charge |
0 |
|
database_cross_reference |
DrugBank:DB00645 Wikipedia:Dyclonine LINCS:LSM-5801 Drug_Central:974 Beilstein:224037 CAS:586-60-7 KEGG:D07881 |
|
definition |
N-Ethylpiperidine in which one of the hydrogens attached to the methyl group is substituted by a 4-butoxybenzoyl group. |
|
formula |
C18H27NO2 |
|
has_exact_synonym |
1-(4-butoxyphenyl)-3-(piperidin-1-yl)propan-1-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4-n-butoxy-beta-(1-piperidyl)propiophenone 3-piperidino-4'-butoxypropiophenone 2-(1-piperidyl)ethyl p-butoxyphenyl ketone 1-(4-butoxyphenyl)-3-(1-piperidinyl)-1-propanone 4'-butoxy-3-piperidinopropiophenone 4-butoxy-beta-piperidinopropiophenone diclonina dyclonine dycloninum |
|
id |
CHEBI:4724 |
|
in_subset | ||
inchi |
InChI=1S/C18H27NO2/c1-2-3-15-21-17-9-7-16(8-10-17)18(20)11-14-19-12-5-4-6-13-19/h7-10H,2-6,11-15H2,1H3 |
|
inchikey |
BZEWSEKUUPWQDQ-UHFFFAOYSA-N |
|
label |
dyclonine |
|
mass |
289.41250 |
|
monoisotopicmass |
289.20418 |
|
notation |
CHEBI:4724 |
|
prefLabel |
dyclonine |
|
RO_0000087 | ||
smiles |
CCCCOc1ccc(cc1)C(=O)CCN1CCCCC1 |
|
subClassOf |