Jump to:
loading...| Preferred Name |
carbapenem |
|
| Synonyms |
2,3-didehydro-1-carbapenam (5R)-1-azabicyclo[3.2.0]hept-2-en-7-one |
|
| Definitions |
An organic heterobicyclic compound that consists of (5R)-1-azabicyclo[3.2.0]hept-2-ene bearing a 7-keto substituent. The parent of the class of carbapenems. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_46765 |
|
| charge |
0 |
|
| definition |
An organic heterobicyclic compound that consists of (5R)-1-azabicyclo[3.2.0]hept-2-ene bearing a 7-keto substituent. The parent of the class of carbapenems. |
|
| formula |
C6H7NO |
|
| has_exact_synonym |
2,3-didehydro-1-carbapenam |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(5R)-1-azabicyclo[3.2.0]hept-2-en-7-one |
|
| id |
CHEBI:46765 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H7NO/c8-6-4-5-2-1-3-7(5)6/h1,3,5H,2,4H2/t5-/m1/s1 |
|
| inchikey |
YZBQHRLRFGPBSL-RXMQYKEDSA-N |
|
| label |
carbapenem |
|
| mass |
109.12592 |
|
| monoisotopicmass |
109.05276 |
|
| notation |
CHEBI:46765 |
|
| prefLabel |
carbapenem |
|
| smiles |
[H][C@]12CC=CN1C(=O)C2 |
|
| subClassOf |
Create mapping