loading...| Preferred Name |
sebacic acid |
|
| Synonyms |
decanedioic acid Sebacic acid SEBACIC ACID Decanedioic acid 1,8-dicarboxyoctane 1,10-decanedioic acid Sebacinsaeure |
|
| Definitions |
An alpha,omega-dicarboxylic acid that is the 1,8-dicarboxy derivative of octane. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_41865 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:1210591 CAS:111-20-6 PMID:9439441 HMDB:HMDB0000792 LIPID_MAPS_instance:LMFA01170006 DrugBank:DB07645 PDBeChem:DEC Beilstein:1210591 PMID:22770225 KNApSAcK:C00001202 MetaCyc:CPD-3623 Wikipedia:Sebacic_acid KEGG:C08277 Gmelin:102423 |
|
| definition |
An alpha,omega-dicarboxylic acid that is the 1,8-dicarboxy derivative of octane. |
|
| formula |
C10H18O4 |
|
| has_alternative_id |
CHEBI:41860 CHEBI:9071 |
|
| has_exact_synonym |
decanedioic acid Sebacic acid SEBACIC ACID |
|
| has_obo_namespace |
chebi_ontology |
|
| has_parent_hydride | ||
| has_related_synonym |
Decanedioic acid 1,8-dicarboxyoctane 1,10-decanedioic acid Sebacinsaeure |
|
| id |
CHEBI:41865 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H18O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14/h1-8H2,(H,11,12)(H,13,14) |
|
| inchikey |
CXMXRPHRNRROMY-UHFFFAOYSA-N |
|
| is_conjugate_acid_of | ||
| label |
sebacic acid |
|
| mass |
202.24752 |
|
| monoisotopicmass |
202.12051 |
|
| notation |
CHEBI:41865 |
|
| prefLabel |
sebacic acid |
|
| RO_0000087 | ||
| smiles |
OC(=O)CCCCCCCCC(O)=O |
|
| subClassOf |