Preferred Name |
cyclopentolate |
|
Synonyms |
Cyclopentolate 2-(dimethylamino)ethyl (1-hydroxycyclopentyl)(phenyl)acetate 2-(dimethylamino)ethyl 2-(1-hydroxycyclopentyl)-2-phenylacetate 1-hydroxy-alpha-phenylcyclopentaneacetic acid 2-(dimethylamino)ethyl ester 2-phenyl-2-(1-hydroxycyclopentyl)ethanoic acid beta-(dimethylamino)ethyl ester beta-dimethylaminoethyl (1-hydroxycyclopentyl)phenylacetate (+-)-cyclopentolate cyclopentolatum 2-(dimethylamino)ethyl 1-hydroxy-alpha-phenylcyclopentaneacetate beta-(dimethylamino)ethyl (1-hydroxycyclopentyl)phenylacetate cyclopentolate ciclopentolato alpha-(1-hydroxycyclopentyl)benzeneacetic acid 2-(dimethylamino)ethyl ester |
|
Definitions |
A carboxylic ester resulting from the formal condensation of (1-hydroxycyclopentyl)(phenyl)acetic acid with N,N-dimethylethanolamine. A tertiary amine antimuscarinic with actions similar to atropine, it is used as its hydrochloride salt to produce mydriasis (excessive dilation of the pupil) and cycloplegia (paralysis of the ciliary muscle of the eye) for opthalmic diagnostic procedures. It acts more quickly than atropine and has a shorter duration of action. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4024 |
|
charge |
0 |
|
database_cross_reference |
CAS:512-15-2 DrugBank:DB00979 HMDB:HMDB0015114 Reaxys:2147087 Drug_Central:757 KEGG:C06932 KEGG:D07759 Beilstein:2147087 Patent:US2554511 LINCS:LSM-1800 Wikipedia:Cyclopentolate |
|
definition |
A carboxylic ester resulting from the formal condensation of (1-hydroxycyclopentyl)(phenyl)acetic acid with N,N-dimethylethanolamine. A tertiary amine antimuscarinic with actions similar to atropine, it is used as its hydrochloride salt to produce mydriasis (excessive dilation of the pupil) and cycloplegia (paralysis of the ciliary muscle of the eye) for opthalmic diagnostic procedures. It acts more quickly than atropine and has a shorter duration of action. |
|
formula |
C17H25NO3 |
|
has_exact_synonym |
Cyclopentolate 2-(dimethylamino)ethyl (1-hydroxycyclopentyl)(phenyl)acetate |
|
has_functional_parent | ||
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-(dimethylamino)ethyl 2-(1-hydroxycyclopentyl)-2-phenylacetate 1-hydroxy-alpha-phenylcyclopentaneacetic acid 2-(dimethylamino)ethyl ester 2-phenyl-2-(1-hydroxycyclopentyl)ethanoic acid beta-(dimethylamino)ethyl ester beta-dimethylaminoethyl (1-hydroxycyclopentyl)phenylacetate (+-)-cyclopentolate cyclopentolatum 2-(dimethylamino)ethyl 1-hydroxy-alpha-phenylcyclopentaneacetate beta-(dimethylamino)ethyl (1-hydroxycyclopentyl)phenylacetate cyclopentolate ciclopentolato alpha-(1-hydroxycyclopentyl)benzeneacetic acid 2-(dimethylamino)ethyl ester |
|
id |
CHEBI:4024 |
|
in_subset | ||
inchi |
InChI=1S/C17H25NO3/c1-18(2)12-13-21-16(19)15(14-8-4-3-5-9-14)17(20)10-6-7-11-17/h3-5,8-9,15,20H,6-7,10-13H2,1-2H3 |
|
inchikey |
SKYSRIRYMSLOIN-UHFFFAOYSA-N |
|
label |
cyclopentolate |
|
mass |
291.38530 |
|
monoisotopicmass |
291.18344 |
|
notation |
CHEBI:4024 |
|
prefLabel |
cyclopentolate |
|
RO_0000087 |
http://purl.obolibrary.org/obo/CHEBI_33295 http://purl.obolibrary.org/obo/CHEBI_50513 |
|
smiles |
CN(C)CCOC(=O)C(c1ccccc1)C1(O)CCCC1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33308 |